Difference between revisions of "RXN-9650"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-458 CPD-458] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GAMPG GAMPG] == * direction: ** LEFT-TO-RIGHT * common name: ** GTP:alpha-D-mannose-1-phosphate gua...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GAMPG GAMPG] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** GTP:alpha-D-mannose-1-phosphate guanylyltransferase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1.0 [[MANNOSE-1P]][c] '''+''' 1.0 [[GTP]][c] '''+''' 1.0 [[PROTON]][c] '''=>''' 1.0 [[PPI]][c] '''+''' 1.0 [[GDP-MANNOSE]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1.0 α-D-mannose 1-phosphate[c] '''+''' 1.0 GTP[c] '''+''' 1.0 H+[c] '''=>''' 1.0 diphosphate[c] '''+''' 1.0 GDP-α-D-mannose[c] |
| − | * [[ | + | |
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_14704]] | ||
| + | ** [[pantograph]]-[[creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=GTP:alpha-D-mannose-1-phosphate guanylyltransferase}} | |
| − | + | {{#set: gene associated=Tiso_gene_14704}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 00:14, 19 March 2018
Contents
Reaction GAMPG
- direction:
- LEFT-TO-RIGHT
- common name:
- GTP:alpha-D-mannose-1-phosphate guanylyltransferase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 MANNOSE-1P[c] + 1.0 GTP[c] + 1.0 PROTON[c] => 1.0 PPI[c] + 1.0 GDP-MANNOSE[c]
- With common name(s):
- 1.0 α-D-mannose 1-phosphate[c] + 1.0 GTP[c] + 1.0 H+[c] => 1.0 diphosphate[c] + 1.0 GDP-α-D-mannose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
