Difference between revisions of "BCor"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ALPHA-ACETYLORNITHINE N-ALPHA-ACETYLORNITHINE] == * smiles: ** CC(=O)NC(CCC[N+])C(=O)[O-] * i...") |
(Created page with "Category:Gene == Gene Tiso_gene_1036 == * left end position: ** 21161 * transcription direction: ** NEGATIVE * right end position: ** 26368 * centisome position: ** 79.780...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1036 == |
− | * | + | * left end position: |
− | ** | + | ** 21161 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 26368 |
− | * | + | * centisome position: |
− | ** | + | ** 79.78058 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[DNA-DIRECTED-RNA-POLYMERASE-RXN]] |
− | * | + | ** in-silico_annotation |
− | + | ***ec-number | |
− | == | + | == Pathways associated == |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=21161}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=26368}} | |
− | + | {{#set: centisome position=79.78058 }} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 01:17, 19 March 2018
Gene Tiso_gene_1036
- left end position:
- 21161
- transcription direction:
- NEGATIVE
- right end position:
- 26368
- centisome position:
- 79.78058
- Synonym(s):
Reactions associated
- DNA-DIRECTED-RNA-POLYMERASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation