Difference between revisions of "Tiso gene 6134"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] == * smiles: ** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-] * inchi key: ** InChIKe...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-I9 PWY-I9] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]
 +
* inchi key:
 +
** InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N
 
* common name:
 
* common name:
−
** L-cysteine biosynthesis VI (from L-methionine)
+
** 4-hydroxy-2-nonenal-[L-Cys] conjugate
 +
* molecular weight:
 +
** 277.378   
 
* Synonym(s):
 
* Synonym(s):
−
** reverse transsulfuration
 
−
** methionine to cysteine transsulfuration
 
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''5''' reactions found over '''7''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]]
+
* [[RXN-13677]]
−
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
* [[O-SUCCHOMOSERLYASE-RXN]]
+
−
* [[RXN-7605]]
+
−
* [[SAM-PWY]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RIBOSYLHOMOCYSTEINASE-RXN RIBOSYLHOMOCYSTEINASE-RXN]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
−
{{#set: common name=L-cysteine biosynthesis VI (from L-methionine)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657989 90657989]
−
{{#set: common name=reverse transsulfuration|methionine to cysteine transsulfuration}}
+
{{#set: smiles=CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]}}
−
{{#set: reaction found=5}}
+
{{#set: inchi key=InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N}}
−
{{#set: reaction not found=7}}
+
{{#set: common name=4-hydroxy-2-nonenal-[L-Cys] conjugate}}
−
{{#set: completion rate=71.0}}
+
{{#set: molecular weight=277.378    }}
 +
{{#set: produced by=RXN-13677}}

Revision as of 18:18, 18 March 2018

Metabolite CPD-14706

  • smiles:
    • CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]
  • inchi key:
    • InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N
  • common name:
    • 4-hydroxy-2-nonenal-[L-Cys] conjugate
  • molecular weight:
    • 277.378
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.
"4-hydroxy-2-nonenal-[L-Cys] conjugate" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6134&oldid=23288"