Difference between revisions of "PWY-321"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] == * smiles: ** C(O)C1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=ZZZCUOFIHG...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C1(C(O)=C(O)C(=O)O1) |
| + | * inchi key: | ||
| + | ** InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** dehydro-D-arabinono-1,4-lactone |
| + | * molecular weight: | ||
| + | ** 146.099 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one | ||
| + | ** D-erythro-ascorbic acid | ||
| + | ** D-erythro-ascorbate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[1.1.3.37-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | * [ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54675775 54675775] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17803 17803] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C06316 C06316] | ||
| + | {{#set: smiles=C(O)C1(C(O)=C(O)C(=O)O1)}} | ||
| + | {{#set: inchi key=InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N}} | ||
| + | {{#set: common name=dehydro-D-arabinono-1,4-lactone}} | ||
| + | {{#set: molecular weight=146.099 }} | ||
| + | {{#set: common name=(5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one|D-erythro-ascorbic acid|D-erythro-ascorbate}} | ||
| + | {{#set: produced by=1.1.3.37-RXN}} | ||
Revision as of 18:20, 18 March 2018
Contents
Metabolite CPD-1789
- smiles:
- C(O)C1(C(O)=C(O)C(=O)O1)
- inchi key:
- InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N
- common name:
- dehydro-D-arabinono-1,4-lactone
- molecular weight:
- 146.099
- Synonym(s):
- (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one
- D-erythro-ascorbic acid
- D-erythro-ascorbate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
