Difference between revisions of "Tiso gene 7036"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENIC_ACID LINOLENIC_ACID] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(=O)[O-] * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10949 RXN-10949] == * direction: ** LEFT-TO-RIGHT * common name: ** myo-inositol-1(or_4)-monoph...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10949 RXN-10949] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** myo-inositol-1(or_4)-monophosphatase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.3.25 EC-3.1.3.25] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[WATER]][c] '''+''' 1 [[Myo-inositol-monophosphates]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[MYO-INOSITOL]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 H2O[c] '''+''' 1 a myo-inositol monophosphate[c] '''=>''' 1 phosphate[c] '''+''' 1 myo-inositol[c] |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_2527]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07343 R07343] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=myo-inositol-1(or_4)-monophosphatase}} | |
− | + | {{#set: ec number=EC-3.1.3.25}} | |
− | * LIGAND- | + | {{#set: gene associated=Tiso_gene_2527}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=}} |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | {{#set: reconstruction source=in-silico_annotation}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:04, 10 January 2018
Contents
Reaction RXN-10949
- direction:
- LEFT-TO-RIGHT
- common name:
- myo-inositol-1(or_4)-monophosphatase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 Myo-inositol-monophosphates[c] => 1 Pi[c] + 1 MYO-INOSITOL[c]
- With common name(s):
- 1 H2O[c] + 1 a myo-inositol monophosphate[c] => 1 phosphate[c] + 1 myo-inositol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_2527
- IN-SILICO_ANNOTATION
- AUTOMATED-NAME-MATCH
- IN-SILICO_ANNOTATION
Pathways
Reconstruction information
External links
- LIGAND-RXN: