Difference between revisions of "RXN-16483"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MANNONATE D-MANNONATE] == * smiles: ** C(O)C(C(O)C(O)C(C([O-])=O)O)O * inchi key: ** InChIKey...") |
|||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MANNONATE D-MANNONATE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(O)C(C(O)C(O)C(C([O-])=O)O)O |
+ | * inchi key: | ||
+ | ** InChIKey=RGHNJXZEOKUKBD-MBMOQRBOSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** D-mannonate |
+ | * molecular weight: | ||
+ | ** 195.149 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** mannonate |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[MANNONDEHYDRAT-RXN]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | == Reaction(s) | + | * [[MANNURONATE-REDUCTASE-RXN]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460054 5460054] |
− | {{#set: common name= | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4573735.html 4573735] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17767 17767] |
+ | * BIGG : mana | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00514 C00514] | ||
+ | {{#set: smiles=C(O)C(C(O)C(O)C(C([O-])=O)O)O}} | ||
+ | {{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-MBMOQRBOSA-M}} | ||
+ | {{#set: common name=D-mannonate}} | ||
+ | {{#set: molecular weight=195.149 }} | ||
+ | {{#set: common name=mannonate}} | ||
+ | {{#set: consumed by=MANNONDEHYDRAT-RXN}} | ||
+ | {{#set: reversible reaction associated=MANNURONATE-REDUCTASE-RXN}} |
Revision as of 18:27, 18 March 2018
Contents
Metabolite D-MANNONATE
- smiles:
- C(O)C(C(O)C(O)C(C([O-])=O)O)O
- inchi key:
- InChIKey=RGHNJXZEOKUKBD-MBMOQRBOSA-M
- common name:
- D-mannonate
- molecular weight:
- 195.149
- Synonym(s):
- mannonate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(C(O)C(O)C(C([O-])=O)O)O" cannot be used as a page name in this wiki.