Difference between revisions of "RXN0-6385"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * smiles: ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) * inchi key: ** InChIKey=WG...") |
(Created page with "Category:Gene == Gene Tiso_gene_3353 == * right end position: ** 16627 * transcription direction: ** POSITIVE * left end position: ** 10904 * centisome position: ** 64.372...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3353 == |
− | * | + | * right end position: |
− | ** | + | ** 16627 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 10904 |
− | * | + | * centisome position: |
− | ** | + | ** 64.37216 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ADENYL-KIN-RXN]] | |
− | == | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=16627}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=10904}} | |
− | + | {{#set: centisome position=64.37216 }} | |
− | + | {{#set: reaction associated=ADENYL-KIN-RXN}} | |
− | {{#set: | + | {{#set: pathway associated=PWY-7219}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:44, 21 March 2018
Gene Tiso_gene_3353
- right end position:
- 16627
- transcription direction:
- POSITIVE
- left end position:
- 10904
- centisome position:
- 64.37216
- Synonym(s):
Reactions associated
- Reaction: ADENYL-KIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation