Difference between revisions of "RXN-11680"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == * smiles: ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14131 RXN-14131] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14131 RXN-14131] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-(7Z)-tetradecenoyl-CoA
+
** acyl-coenzyme_a_oxidase
−
* molecular weight:
+
** acyl-_dehydrogenase
−
** 985.829   
+
** ORF
 +
** acyl-CoA_dehydrogenase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.8.8 EC-1.3.8.8]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-14:1-Δ7-CoA
 
−
** 3-oxo-7-cis-tetradecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17795]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[ETF-Oxidized]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[TETRADECANOYL-COA]][c] '''=>''' 1 [[ETF-Reduced]][c] '''+''' 1 [[CPD-15568]][c]
−
* [[RXN-17794]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 an oxidized electron-transfer flavoprotein[c] '''+''' 1 H+[c] '''+''' 1 myristoyl-CoA[c] '''=>''' 1 a reduced electron-transfer flavoprotein[c] '''+''' 1 2-trans-tetradecenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_883]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_6475]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18566]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_16631]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5991]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_17967]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7654]], (8E,10E)-dodeca-8,10-dienol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7654 PWY-7654]
 +
** '''6''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* RHEA:
−
{{#set: inchi key=InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J}}
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28359 28359]
−
{{#set: common name=3-oxo-(7Z)-tetradecenoyl-CoA}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=985.829    }}
+
{{#set: common name=acyl-coenzyme_a_oxidase}}
−
{{#set: common name=3-oxo-14:1-Δ7-CoA|3-oxo-7-cis-tetradecenoyl-CoA}}
+
{{#set: common name=acyl-_dehydrogenase}}
−
{{#set: consumed by=RXN-17795}}
+
{{#set: common name=ORF}}
−
{{#set: produced by=RXN-17794}}
+
{{#set: common name=acyl-CoA_dehydrogenase}}
 +
{{#set: ec number=EC-1.3.8.8}}
 +
{{#set: gene associated=Tiso_gene_883|Tiso_gene_6475|Tiso_gene_18566|Tiso_gene_16631|Tiso_gene_5991|Tiso_gene_17967}}
 +
{{#set: in pathway=PWY-7654}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 14:45, 21 March 2018

Reaction RXN-14131

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl-coenzyme_a_oxidase
    • acyl-_dehydrogenase
    • ORF
    • acyl-CoA_dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 an oxidized electron-transfer flavoprotein[c] + 1 H+[c] + 1 myristoyl-CoA[c] => 1 a reduced electron-transfer flavoprotein[c] + 1 2-trans-tetradecenoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7654, (8E,10E)-dodeca-8,10-dienol biosynthesis: PWY-7654
    • 6 reactions found over 11 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-11680&oldid=29875"