Difference between revisions of "Oxo-glutarate-dehydro-suc-DH-lipoyl"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6012 PWY-6012] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * common name: ** α-D-ribofur...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6012 PWY-6012] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C(C1(C(C(C(O1)O)O)O))O
 
* common name:
 
* common name:
−
** acyl carrier protein metabolism
+
** α-D-ribofuranose
 +
* inchi key:
 +
** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
 +
* molecular weight:
 +
** 150.131   
 
* Synonym(s):
 
* Synonym(s):
−
** [acp] metabolism
+
** α D-ribose
−
** ACP metabolism
+
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''2''' reactions in the full pathway
+
* [[RIBOKIN-RXN]]
−
* [[HOLO-ACP-SYNTH-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 2 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_14278]]
+
* [[RXN-14904]]
−
*** [[Tiso_gene_12201]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=3.1.4.14-RXN 3.1.4.14-RXN]
+
 
== External links  ==
 
== External links  ==
−
* ECOCYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6012 PWY-6012]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894]
−
{{#set: taxonomic range=TAX-2}}
+
* CHEMSPIDER:
−
{{#set: common name=acyl carrier protein metabolism}}
+
** [http://www.chemspider.com/Chemical-Structure.5575.html 5575]
−
{{#set: common name=[acp] metabolism|ACP metabolism}}
+
* CHEBI:
−
{{#set: reaction found=1}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506]
−
{{#set: total reaction=2}}
+
* HMDB : HMDB00283
−
{{#set: completion rate=50.0}}
+
{{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}}
 +
{{#set: common name=α-D-ribofuranose}}
 +
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}}
 +
{{#set: molecular weight=150.131    }}
 +
{{#set: common name=α D-ribose}}
 +
{{#set: consumed by=RIBOKIN-RXN}}
 +
{{#set: reversible reaction associated=RXN-14904}}

Revision as of 14:45, 21 March 2018

Metabolite CPD-10330

  • smiles:
    • C(C1(C(C(C(O1)O)O)O))O
  • common name:
    • α-D-ribofuranose
  • inchi key:
    • InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
  • molecular weight:
    • 150.131
  • Synonym(s):
    • α D-ribose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Oxo-glutarate-dehydro-suc-DH-lipoyl&oldid=29904"