Difference between revisions of "GAMA-TOCOPHEROL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5461 PWY-5461] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3524 TAX-35...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] == * smiles: ** CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5461 PWY-5461] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3524 TAX-3524]
+
** CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))
 
* common name:
 
* common name:
** betanidin degradation
+
** N-acetyl-serotonin glucuronide
 +
* inchi key:
 +
** InChIKey=DRKQFNYKSNWOTC-RNGZQALNSA-M
 +
* molecular weight:
 +
** 393.372   
 
* Synonym(s):
 
* Synonym(s):
 +
** N-acetyl-5-hydroxytryptamine glucuronide
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''1''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[RXN-8635]]
+
* [[RXN-11060]]
** 11 associated gene(s):
+
== Reaction(s) of unknown directionality ==
*** [[Tiso_gene_15820]]
+
*** [[Tiso_gene_17551]]
+
*** [[Tiso_gene_20206]]
+
*** [[Tiso_gene_6431]]
+
*** [[Tiso_gene_5857]]
+
*** [[Tiso_gene_9359]]
+
*** [[Tiso_gene_16028]]
+
*** [[Tiso_gene_19683]]
+
*** [[Tiso_gene_11016]]
+
*** [[Tiso_gene_7067]]
+
*** [[Tiso_gene_15962]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-esiliculosus]]
+
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-3524}}
+
* PUBCHEM:
{{#set: common name=betanidin degradation}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=29971053 29971053]
{{#set: reaction found=1}}
+
{{#set: smiles=CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))}}
{{#set: total reaction=1}}
+
{{#set: common name=N-acetyl-serotonin glucuronide}}
{{#set: completion rate=100.0}}
+
{{#set: inchi key=InChIKey=DRKQFNYKSNWOTC-RNGZQALNSA-M}}
 +
{{#set: molecular weight=393.372    }}
 +
{{#set: common name=N-acetyl-5-hydroxytryptamine glucuronide}}
 +
{{#set: produced by=RXN-11060}}

Revision as of 15:45, 21 March 2018

Metabolite CPD-12016

  • smiles:
    • CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))
  • common name:
    • N-acetyl-serotonin glucuronide
  • inchi key:
    • InChIKey=DRKQFNYKSNWOTC-RNGZQALNSA-M
  • molecular weight:
    • 393.372
  • Synonym(s):
    • N-acetyl-5-hydroxytryptamine glucuronide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))" cannot be used as a page name in this wiki.