Difference between revisions of "FLAVANONES"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAMIN-PYROPHOSPHOKINASE-RXN THIAMIN-PYROPHOSPHOKINASE-RXN] == * direction: ** LEFT-TO-RIGHT * com...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAMIN-PYROPHOSPHOKINASE-RXN THIAMIN-PYROPHOSPHOKINASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** thiamine_pyrophosphokinase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.6.2 EC-2.7.6.2] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[THIAMINE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[THIAMINE-PYROPHOSPHATE]][c] '''+''' 1 [[PROTON]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 thiamine[c] '''+''' 1 ATP[c] '''=>''' 1 AMP[c] '''+''' 1 thiamine diphosphate[c] '''+''' 1 H+[c] |
− | * [[ | + | |
− | = | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Tiso_gene_16512]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6907]], thiamine diphosphate biosynthesis III (Staphylococcus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6907 PWY-6907] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-6898]], thiamine salvage III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6898 PWY-6898] | ||
+ | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
+ | * [[PWY-7356]], thiamine salvage IV (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356] | ||
+ | ** '''5''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-6908]], thiamine diphosphate biosynthesis IV (eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6908 PWY-6908] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11576 11576] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00619 R00619] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P35202 P35202] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P41888 P41888] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | ** [http://www. | + | {{#set: common name=thiamine_pyrophosphokinase}} |
− | + | {{#set: ec number=EC-2.7.6.2}} | |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_16512}} |
− | {{#set: | + | {{#set: in pathway=PWY-6907|PWY-6898|PWY-7356|PWY-6908}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:45, 21 March 2018
Contents
Reaction THIAMIN-PYROPHOSPHOKINASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- thiamine_pyrophosphokinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 THIAMINE[c] + 1 ATP[c] => 1 AMP[c] + 1 THIAMINE-PYROPHOSPHATE[c] + 1 PROTON[c]
- With common name(s):
- 1 thiamine[c] + 1 ATP[c] => 1 AMP[c] + 1 thiamine diphosphate[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16512
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- PWY-6907, thiamine diphosphate biosynthesis III (Staphylococcus): PWY-6907
- 3 reactions found over 3 reactions in the full pathway
- PWY-6898, thiamine salvage III: PWY-6898
- 1 reactions found over 1 reactions in the full pathway
- PWY-7356, thiamine salvage IV (yeast): PWY-7356
- 5 reactions found over 7 reactions in the full pathway
- PWY-6908, thiamine diphosphate biosynthesis IV (eukaryotes): PWY-6908
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links