Difference between revisions of "TRANS-RXN0-623"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == * smiles: ** CN1(C=NC2(NC(=O)NC(=O)C1=2)) * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLCURK GLCURK] == * direction: ** LEFT-TO-RIGHT * common name: ** Glucuronokinase * Synonym(s): ==...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLCURK GLCURK] ==
−
* smiles:
+
* direction:
−
** CN1(C=NC2(NC(=O)NC(=O)C1=2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 7-methylxanthine
+
** Glucuronokinase
−
* molecular weight:
+
−
** 166.139   
+
 
* Synonym(s):
 
* Synonym(s):
−
** heteroxanthine
 
−
** 3,7-dihydro-7-methyl-1H-purine-2,6-dione
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11521]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ATP]][c] '''+''' 1.0 [[D-Glucopyranuronate]][c] '''=>''' 1.0 [[ADP]][c] '''+''' 1.0 [[CPD-510]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 ATP[c] '''+''' 1.0 D-glucopyranuronate[c] '''=>''' 1.0 ADP[c] '''+''' 1.0 α-D-glucuronate 1-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12191]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68374 68374]
+
{{#set: common name=Glucuronokinase}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_12191}}
−
** [http://www.chemspider.com/Chemical-Structure.61660.html 61660]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48991 48991]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16353 C16353]
+
−
* HMDB : HMDB01991
+
−
{{#set: smiles=CN1(C=NC2(NC(=O)NC(=O)C1=2))}}
+
−
{{#set: inchi key=InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N}}
+
−
{{#set: common name=7-methylxanthine}}
+
−
{{#set: molecular weight=166.139    }}
+
−
{{#set: common name=heteroxanthine|3,7-dihydro-7-methyl-1H-purine-2,6-dione}}
+
−
{{#set: consumed by=RXN-11521}}
+

Revision as of 14:45, 21 March 2018

Reaction GLCURK

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glucuronokinase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 ATP[c] + 1.0 D-glucopyranuronate[c] => 1.0 ADP[c] + 1.0 α-D-glucuronate 1-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TRANS-RXN0-623&oldid=29991"