Difference between revisions of "Tiso gene 19611"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O) * inchi k...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pyruvate-dehydrogenase-dihydrolipoate Pyruvate-dehydrogenase-dihydrolipoate] == * common name:...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pyruvate-dehydrogenase-dihydrolipoate Pyruvate-dehydrogenase-dihydrolipoate] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a [pyruvate dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-1133]] |
| − | * [[ | + | * [[RXN0-1132]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a [pyruvate dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine}} | |
| − | + | {{#set: consumed by=RXN0-1133|RXN0-1132}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | + | ||
Revision as of 14:46, 21 March 2018
Contents
Metabolite Pyruvate-dehydrogenase-dihydrolipoate
- common name:
- a [pyruvate dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [pyruvate dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine" cannot be used as a page name in this wiki.
