Difference between revisions of "CPD1F-95"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13144 == * left end position: ** 4873 * transcription direction: ** POSITIVE * right end position: ** 6355 * centisome position: ** 74.9923...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] == * smiles: ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] == |
| − | * | + | * smiles: |
| − | ** | + | ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3))) |
| − | * | + | * common name: |
| − | ** | + | ** L-thyroxine acyl β-D-glucuronide |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HMTFXPJOBPIOIN-DKBYMCRTSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 951.992 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10608]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657991 90657991] |
| − | {{#set: | + | {{#set: smiles=C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))}} |
| − | {{#set: | + | {{#set: common name=L-thyroxine acyl β-D-glucuronide}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=HMTFXPJOBPIOIN-DKBYMCRTSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=951.992 }} |
| + | {{#set: produced by=RXN-10608}} | ||
Revision as of 14:46, 21 March 2018
Contents
Metabolite CPD-11401
- smiles:
- C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))
- common name:
- L-thyroxine acyl β-D-glucuronide
- inchi key:
- InChIKey=HMTFXPJOBPIOIN-DKBYMCRTSA-M
- molecular weight:
- 951.992
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))" cannot be used as a page name in this wiki.
