Difference between revisions of "Tiso gene 17230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] == * smiles: ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=X5NT X5NT] == * direction: ** LEFT-TO-RIGHT * common name: ** XMP-5'-nucleotidase * Synonym(s): ==...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=X5NT X5NT] ==
−
* smiles:
+
* direction:
−
** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HMTFXPJOBPIOIN-DKBYMCRTSA-M
+
 
* common name:
 
* common name:
−
** L-thyroxine acyl β-D-glucuronide
+
** XMP-5'-nucleotidase
−
* molecular weight:
+
−
** 951.992   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-10608]]
+
** 1.0 [[XANTHOSINE-5-PHOSPHATE]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[XANTHOSINE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 XMP[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 phosphate[c] '''+''' 1.0 xanthosine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6988]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_9166]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657991 90657991]
+
{{#set: common name=XMP-5'-nucleotidase}}
−
{{#set: smiles=C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))}}
+
{{#set: gene associated=Tiso_gene_6988|Tiso_gene_9166}}
−
{{#set: inchi key=InChIKey=HMTFXPJOBPIOIN-DKBYMCRTSA-M}}
+
{{#set: in pathway=}}
−
{{#set: common name=L-thyroxine acyl β-D-glucuronide}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=951.992    }}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: produced by=RXN-10608}}
+
{{#set: reconstruction tool=pantograph}}

Revision as of 14:46, 21 March 2018

Reaction X5NT

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • XMP-5'-nucleotidase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17230&oldid=30018"