Difference between revisions of "Tiso gene 18091"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * inchi key: ** InChIKey=QZBYOYPROV...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6614 PWY-6614] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6614 PWY-6614] ==
−
* smiles:
+
* taxonomic range:
−
** C(CC[N+]CCCCC[N+])[N+]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** aminopropylcadaverine
+
** tetrahydrofolate biosynthesis
−
* molecular weight:
+
−
** 162.298   
+
 
* Synonym(s):
 
* Synonym(s):
−
** N-3-aminopropyl-1,5-diaminopentane
+
** folic acid biosynthesis
 +
** folate biosynthesis
 +
** THF biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''3''' reactions in the full pathway
−
* [[RXN0-5217]]
+
* [[DIHYDROFOLATEREDUCT-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
* [[DIHYDROFOLATESYNTH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_15942]]
 +
*** [[Tiso_gene_92]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
* [[H2PTEROATESYNTH-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_11659]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6614 PWY-6614]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858]
+
{{#set: taxonomic range=TAX-4751}}
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565]
+
{{#set: common name=tetrahydrofolate biosynthesis}}
−
* HMDB : HMDB12189
+
{{#set: common name=folic acid biosynthesis|folate biosynthesis|THF biosynthesis}}
−
{{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}}
+
{{#set: reaction found=3}}
−
{{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}}
+
{{#set: total reaction=3}}
−
{{#set: common name=aminopropylcadaverine}}
+
{{#set: completion rate=100.0}}
−
{{#set: molecular weight=162.298    }}
+
−
{{#set: common name=N-3-aminopropyl-1,5-diaminopentane}}
+
−
{{#set: produced by=RXN0-5217}}
+

Revision as of 14:46, 21 March 2018

Pathway PWY-6614

  • taxonomic range:
  • common name:
    • tetrahydrofolate biosynthesis
  • Synonym(s):
    • folic acid biosynthesis
    • folate biosynthesis
    • THF biosynthesis

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18091&oldid=30022"