Difference between revisions of "Tiso gene 18325"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-602 RXN-602] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.14...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] == * smiles: ** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-602 RXN-602] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/1.14.11.19 EC-1.14.11.19]
+
** 4-trans-3-oxo-undecenoyl-CoA
 +
* inchi key:
 +
** InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J
 +
* molecular weight:
 +
** 943.749   
 
* Synonym(s):
 
* Synonym(s):
** Leucoanthocyanidin dioxygenase
+
** 4E-3-oxo-undecenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-14793]]
** 1 [[CPD-590]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''=>''' 2 [[WATER]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[SUC]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-591]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 (2R,3S,4S)-leucocyanidin[c] '''+''' 1 oxygen[c] '''+''' 1 2-oxoglutarate[c] '''=>''' 2 H2O[c] '''+''' 1 H+[c] '''+''' 1 succinate[c] '''+''' 1 CO2[c] '''+''' 1 cyanidin[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_3330]]
+
** [[pantograph]]-[[athaliana]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-athaliana]]
+
*** Tool: [[pantograph]]
+
** Source: [[orthology-esiliculosus]]
+
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R05036 R05036]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658908 90658908]
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: ec number=EC-1.14.11.19}}
+
{{#set: common name=4-trans-3-oxo-undecenoyl-CoA}}
{{#set: common name=Leucoanthocyanidin dioxygenase}}
+
{{#set: inchi key=InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J}}
{{#set: gene associated=Tiso_gene_3330}}
+
{{#set: molecular weight=943.749    }}
{{#set: in pathway=}}
+
{{#set: common name=4E-3-oxo-undecenoyl-CoA}}
{{#set: reconstruction category=orthology}}
+
{{#set: consumed by=RXN-14793}}
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
+
{{#set: reconstruction tool=pantograph}}
+

Revision as of 15:46, 21 March 2018

Metabolite CPD-15678

  • smiles:
    • CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 4-trans-3-oxo-undecenoyl-CoA
  • inchi key:
    • InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J
  • molecular weight:
    • 943.749
  • Synonym(s):
    • 4E-3-oxo-undecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.