Difference between revisions of "GLYSYN-ALA-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BIOTINLIG-RXN BIOTINLIG-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=BIOTINLIG-RXN BIOTINLIG-RXN] ==
−
* smiles:
+
* direction:
−
** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N
+
 
* common name:
 
* common name:
−
** delphinidin 3,5-di-O-β-D-glucoside
+
** ORF
−
* molecular weight:
+
* ec number:
−
** 626.524   
+
** [http://enzyme.expasy.org/EC/6.3.4.15 EC-6.3.4.15]
 
* Synonym(s):
 
* Synonym(s):
−
** delphinidin-3,5-diglucoside
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-8228]]
+
** 1 [[BCCP-monomers]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[BIOTIN]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[BCCP-biotin-monomers]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a [biotin-carboxyl-carrier protein monomer][c] '''+''' 1 ATP[c] '''+''' 1 biotin[c] '''=>''' 1 AMP[c] '''+''' 1 H+[c] '''+''' 1 diphosphate[c] '''+''' 1 a biotinylated [BCCP monomer][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14184]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_8713]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_17216]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY0-1264]], biotin-carboxyl carrier protein assembly: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1264 PWY0-1264]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* UNIPROT:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201902 25201902]
+
** [http://www.uniprot.org/uniprot/P06709 P06709]
−
* CHEBI:
+
** [http://www.uniprot.org/uniprot/Q9PJ27 Q9PJ27]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77838 77838]
+
** [http://www.uniprot.org/uniprot/Q9CEQ6 Q9CEQ6]
−
* LIGAND-CPD:
+
** [http://www.uniprot.org/uniprot/Q9CED9 Q9CED9]
−
** [http://www.genome.jp/dbget-bin/www_bget?C16312 C16312]
+
** [http://www.uniprot.org/uniprot/Q9JWI7 Q9JWI7]
−
* HMDB : HMDB30693
+
** [http://www.uniprot.org/uniprot/P48445 P48445]
−
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))}}
+
** [http://www.uniprot.org/uniprot/P72816 P72816]
−
{{#set: inchi key=InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: common name=delphinidin 3,5-di-O-β-D-glucoside}}
+
{{#set: common name=ORF}}
−
{{#set: molecular weight=626.524    }}
+
{{#set: ec number=EC-6.3.4.15}}
−
{{#set: common name=delphinidin-3,5-diglucoside}}
+
{{#set: gene associated=Tiso_gene_14184|Tiso_gene_8713|Tiso_gene_17216}}
−
{{#set: produced by=RXN-8228}}
+
{{#set: in pathway=PWY0-1264}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 15:46, 21 March 2018

Reaction BIOTINLIG-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a [biotin-carboxyl-carrier protein monomer][c] + 1 ATP[c] + 1 biotin[c] => 1 AMP[c] + 1 H+[c] + 1 diphosphate[c] + 1 a biotinylated [BCCP monomer][c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-1264, biotin-carboxyl carrier protein assembly: PWY0-1264
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GLYSYN-ALA-PWY&oldid=30114"