Difference between revisions of "Tiso gene 10743"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2451 == * left end position: ** 9261 * transcription direction: ** POSITIVE * right end position: ** 9821 * centisome position: ** 47.72481...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * smiles: ** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4)) *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4)) |
| − | * | + | * common name: |
| − | ** | + | ** pregn-5-ene-3,20-dione-17-ol |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 330.466 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN66-350]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14562950 14562950] |
| − | {{#set: | + | {{#set: smiles=CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))}} |
| − | {{#set: | + | {{#set: common name=pregn-5-ene-3,20-dione-17-ol}} |
| − | {{#set: reaction associated= | + | {{#set: inchi key=InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N}} |
| − | + | {{#set: molecular weight=330.466 }} | |
| + | {{#set: reversible reaction associated=RXN66-350}} | ||
Revision as of 14:47, 21 March 2018
Contents
Metabolite CPD66-27
- smiles:
- CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))
- common name:
- pregn-5-ene-3,20-dione-17-ol
- inchi key:
- InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N
- molecular weight:
- 330.466
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
