Difference between revisions of "RXN-9538"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6151 PWY-6151] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] == * smiles: ** CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] == |
− | * | + | * smiles: |
− | ** [ | + | ** CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | ** | + | * inchi key: |
+ | ** InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 5-methyl-3-oxo-4-hexenoyl-CoA |
+ | * molecular weight: | ||
+ | ** 887.641 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-11921]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986120 50986120] |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16471 C16471] |
− | {{#set: | + | * HMDB : HMDB60399 |
− | {{#set: common name= | + | {{#set: smiles=CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J}} |
− | {{#set: | + | {{#set: common name=5-methyl-3-oxo-4-hexenoyl-CoA}} |
+ | {{#set: molecular weight=887.641 }} | ||
+ | {{#set: consumed by=RXN-11921}} |
Revision as of 17:06, 10 January 2018
Contents
Metabolite CPD-12906
- smiles:
- CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J
- common name:
- 5-methyl-3-oxo-4-hexenoyl-CoA
- molecular weight:
- 887.641
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.