Difference between revisions of "Tiso gene 6621"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] == * smiles: ** CC([CH]=O)C(=O)[O-] * inchi key: ** InChIKey=VOKUMXABRRXHA...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6643 PWY-6643] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2191 TAX-21...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6643 PWY-6643] ==
−
* smiles:
+
* taxonomic range:
−
** CC([CH]=O)C(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2191 TAX-2191]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-94695 TAX-94695]
−
** InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
+
 
* common name:
 
* common name:
−
** (R)-methylmalonate-semialdehyde
+
** coenzyme M biosynthesis II
−
* molecular weight:
+
−
** 101.082   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (R)-2-methyl-3-oxopropanoate
+
** CoM biosynthesis II
−
** (R)-ch3-malonate-semialdehyde
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''6''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-11737]]
−
* [[RXN-14056]]
+
** 6 associated gene(s):
 +
*** [[Tiso_gene_13538]]
 +
*** [[Tiso_gene_15680]]
 +
*** [[Tiso_gene_6815]]
 +
*** [[Tiso_gene_12889]]
 +
*** [[Tiso_gene_17809]]
 +
*** [[Tiso_gene_17718]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R231-RXN R231-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R232-RXN R232-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R233-RXN R233-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R234-RXN R234-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11108 RXN-11108]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2191}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173310 46173310]
+
{{#set: taxonomic range=TAX-94695}}
−
{{#set: smiles=CC([CH]=O)C(=O)[O-]}}
+
{{#set: common name=coenzyme M biosynthesis II}}
−
{{#set: inchi key=InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M}}
+
{{#set: common name=CoM biosynthesis II}}
−
{{#set: common name=(R)-methylmalonate-semialdehyde}}
+
{{#set: reaction found=1}}
−
{{#set: molecular weight=101.082    }}
+
{{#set: total reaction=6}}
−
{{#set: common name=(R)-2-methyl-3-oxopropanoate|(R)-ch3-malonate-semialdehyde}}
+
{{#set: completion rate=17.0}}
−
{{#set: reversible reaction associated=RXN-14056}}
+

Revision as of 15:48, 21 March 2018

Pathway PWY-6643

  • taxonomic range:
  • common name:
    • coenzyme M biosynthesis II
  • Synonym(s):
    • CoM biosynthesis II

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6621&oldid=30340"