Difference between revisions of "GALACTARDEG-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_2851 == * left end position: ** 17117 * transcription direction: ** POSITIVE * right end position: ** 18195 * centisome position: ** 93.617...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2851 == |
− | * | + | * left end position: |
− | ** | + | ** 17117 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 18195 |
− | * | + | * centisome position: |
− | ** | + | ** 93.61737 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * [[INORGPYROPHOSPHAT-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
− | == | + | ***ec-number |
+ | * [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7805]] | ||
+ | * [[PWY-7807]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=17117}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=18195}} | |
− | {{#set: | + | {{#set: centisome position=93.61737 }} |
− | {{#set: | + | {{#set: reaction associated=INORGPYROPHOSPHAT-RXN|TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY-7805|PWY-7807}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:06, 10 January 2018
Gene Tiso_gene_2851
- left end position:
- 17117
- transcription direction:
- POSITIVE
- right end position:
- 18195
- centisome position:
- 93.61737
- Synonym(s):
Reactions associated
- INORGPYROPHOSPHAT-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation