Difference between revisions of "PWY-5410"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * inchi key: ** InChIKey=ZUKPVRWZD...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16094 RXN-16094] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16094 RXN-16094] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/2.3.1.199 EC-2.3.1.199] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[PROTON]][c] '''+''' 1 [[MALONYL-COA]][c] '''+''' 1 [[CPD-18]][c] '''=>''' 1 [[CPD-17346]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 H+[c] '''+''' 1 malonyl-CoA[c] '''+''' 1 linoleoyl-CoA[c] '''=>''' 1 3-oxo-(11Z,14Z)-icosa-11,14-dienoyl-CoA[c] '''+''' 1 coenzyme A[c] '''+''' 1 CO2[c] |
| − | * [[ | + | |
| − | == | + | == Genes associated with this reaction == |
| + | == Pathways == | ||
| + | * [[PWY-7601]], arachidonate biosynthesis IV (8-detaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7601 PWY-7601] | ||
| + | ** '''7''' reactions found over '''7''' reactions in the full pathway | ||
| + | * [[PWY-7725]], arachidonate biosynthesis V (8-detaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7725 PWY-7725] | ||
| + | ** '''4''' reactions found over '''6''' reactions in the full pathway | ||
| + | * [[PWY-6598]], sciadonate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6598 PWY-6598] | ||
| + | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-2.3.1.199}} | |
| − | + | {{#set: in pathway=PWY-7601|PWY-7725|PWY-6598}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Revision as of 14:49, 21 March 2018
Contents
Reaction RXN-16094
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 MALONYL-COA[c] + 1 CPD-18[c] => 1 CPD-17346[c] + 1 CO-A[c] + 1 CARBON-DIOXIDE[c]
- With common name(s):
- 1 H+[c] + 1 malonyl-CoA[c] + 1 linoleoyl-CoA[c] => 1 3-oxo-(11Z,14Z)-icosa-11,14-dienoyl-CoA[c] + 1 coenzyme A[c] + 1 CO2[c]
Genes associated with this reaction
Pathways
- PWY-7601, arachidonate biosynthesis IV (8-detaturase, lower eukaryotes): PWY-7601
- 7 reactions found over 7 reactions in the full pathway
- PWY-7725, arachidonate biosynthesis V (8-detaturase, mammals): PWY-7725
- 4 reactions found over 6 reactions in the full pathway
- PWY-6598, sciadonate biosynthesis: PWY-6598
- 4 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
