Difference between revisions of "CINNAMOYL-COA"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOSERKIN-RXN HOMOSERKIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** homoserine_kinase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * common name: ** &bet...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == |
− | * | + | * smiles: |
− | ** | + | ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O |
* common name: | * common name: | ||
− | ** | + | ** β-D-glucose 6-phosphate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L |
+ | * molecular weight: | ||
+ | ** 258.121 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** β-D-glucose-6-P | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[G6PBDHh]] | |
− | + | * [[RXN66-579]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[PGIB]] | |
− | = | + | * [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]] |
− | + | * [[G6PI]] | |
− | * [[ | + | * [[G6PB_pi_th]] |
− | + | * [[PGIBh]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865] |
− | * LIGAND- | + | * HMDB : HMDB03498 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * LIGAND-CPD: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172] |
− | ** [http://www. | + | * CHEMSPIDER: |
− | + | ** [http://www.chemspider.com/Chemical-Structure.10239176.html 10239176] | |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58247 58247] |
− | + | * BIGG : g6p | |
− | + | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}} | |
− | * | + | {{#set: common name=β-D-glucose 6-phosphate}} |
− | + | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L}} | |
− | + | {{#set: molecular weight=258.121 }} | |
− | + | {{#set: common name=β-D-glucose-6-P}} | |
− | + | {{#set: consumed by=G6PBDHh|RXN66-579}} | |
− | {{#set: | + | {{#set: reversible reaction associated=PGIB|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN|G6PI|G6PB_pi_th|PGIBh}} |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 14:49, 21 March 2018
Contents
Metabolite GLC-6-P
- smiles:
- C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
- common name:
- β-D-glucose 6-phosphate
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
- molecular weight:
- 258.121
- Synonym(s):
- β-D-glucose-6-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.