Difference between revisions of "Tiso gene 20047"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9973 CPD-9973] == * common name: ** an [eIF5A-precursor]-deoxyhypusine * Synonym(s): ** a p...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9973 CPD-9973] ==
* smiles:
+
** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
* inchi key:
+
** InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
+
 
* common name:
 
* common name:
** 14-oxolanosterol
+
** an [eIF5A-precursor]-deoxyhypusine
* molecular weight:
+
** 440.708   
+
 
* Synonym(s):
 
* Synonym(s):
** 14-oxo-lanosterol
+
** a protein deoxyhypusine
** 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol
+
** a protein N6-(4-aminobutyl)-L-lysine
 +
** an eIF5A deoxyhypusine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-305]]
+
* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-304]]
+
* [[RXN-13417]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an [eIF5A-precursor]-deoxyhypusine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21121725 21121725]
+
{{#set: common name=a protein deoxyhypusine|a protein N6-(4-aminobutyl)-L-lysine|an eIF5A deoxyhypusine}}
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: consumed by=DEOXYHYPUSINE-MONOOXYGENASE-RXN}}
{{#set: inchi key=InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N}}
+
{{#set: produced by=RXN-13417}}
{{#set: common name=14-oxolanosterol}}
+
{{#set: molecular weight=440.708    }}
+
{{#set: common name=14-oxo-lanosterol|4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: consumed by=RXN66-305}}
+
{{#set: produced by=RXN66-304}}
+

Revision as of 14:50, 21 March 2018

Metabolite CPD-9973

  • common name:
    • an [eIF5A-precursor]-deoxyhypusine
  • Synonym(s):
    • a protein deoxyhypusine
    • a protein N6-(4-aminobutyl)-L-lysine
    • an eIF5A deoxyhypusine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [eIF5A-precursor]-deoxyhypusine" cannot be used as a page name in this wiki.