Difference between revisions of "Tiso gene 16101"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * smiles: ** C(CC(C(=O)[O-])[N+])(N)=O * inchi key: ** InChIKey=DCXYFEDJOCDNAF-REOH...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-TYR-tRNAs Charged-TYR-tRNAs] == * common name: ** an L-tyrosyl-[tRNAtyr] * Synonym(s):...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-TYR-tRNAs Charged-TYR-tRNAs] ==
−
* smiles:
+
−
** C(CC(C(=O)[O-])[N+])(N)=O
+
−
* inchi key:
+
−
** InChIKey=DCXYFEDJOCDNAF-REOHCLBHSA-N
+
 
* common name:
 
* common name:
−
** L-asparagine
+
** an L-tyrosyl-[tRNAtyr]
−
* molecular weight:
+
−
** 132.119   
+
 
* Synonym(s):
 
* Synonym(s):
−
** asparagine
 
−
** α-aminosuccinamic acid
 
−
** (-)-asparagine
 
−
** (S)-2,4-diamino-4-oxobutanoic acid
 
−
** (S)-asparagine
 
−
** 2,4-diamino-4-oxobutanoic acid, (S)-
 
−
** 2-aminosuccinamic acid, L-
 
−
** agedoite
 
−
** altheine
 
−
** asparagine acid
 
−
** aspartic acid β-amide
 
−
** butanoic acid, 2,4-diamino-4-oxo-, (S)-
 
−
** L-2,4-diamino-4-oxobutanoic acid
 
−
** L-asparatamine
 
−
** L-β-asparagine
 
−
** asn
 
−
** N
 
−
** L-asn
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[ASPARAGHYD-RXN]]
 
−
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
 
−
* [[RME144]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-12460]]
+
* [[TYROSINE--TRNA-LIGASE-RXN]]
−
* [[ASNSYNA-RXN]]
+
−
* [[ASNSYNB-RXN]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 70-47-3
+
{{#set: common name=an L-tyrosyl-[tRNAtyr]}}
−
* METABOLIGHTS : MTBLC58048
+
{{#set: produced by=TYROSINE--TRNA-LIGASE-RXN}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992089 6992089]
+
−
* HMDB : HMDB00168
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00152 C00152]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58048 58048]
+
−
* BIGG : asn__L
+
−
{{#set: smiles=C(CC(C(=O)[O-])[N+])(N)=O}}
+
−
{{#set: inchi key=InChIKey=DCXYFEDJOCDNAF-REOHCLBHSA-N}}
+
−
{{#set: common name=L-asparagine}}
+
−
{{#set: molecular weight=132.119    }}
+
−
{{#set: common name=asparagine|α-aminosuccinamic acid|(-)-asparagine|(S)-2,4-diamino-4-oxobutanoic acid|(S)-asparagine|2,4-diamino-4-oxobutanoic acid, (S)-|2-aminosuccinamic acid, L-|agedoite|altheine|asparagine acid|aspartic acid β-amide|butanoic acid, 2,4-diamino-4-oxo-, (S)-|L-2,4-diamino-4-oxobutanoic acid|L-asparatamine|L-β-asparagine|asn|N|L-asn}}
+
−
{{#set: consumed by=ASPARAGHYD-RXN|ASPARAGINE--TRNA-LIGASE-RXN|RME144}}
+
−
{{#set: produced by=RXN-12460|ASNSYNA-RXN|ASNSYNB-RXN}}
+

Revision as of 14:50, 21 March 2018

Metabolite Charged-TYR-tRNAs

  • common name:
    • an L-tyrosyl-[tRNAtyr]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an L-tyrosyl-[tRNAtyr" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16101&oldid=30585"