Difference between revisions of "Tiso gene 3579"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] == * smiles: ** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7456 PWY-7456] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7456 PWY-7456] ==
* smiles:
+
* taxonomic range:
** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N
+
 
* common name:
 
* common name:
** 26,27-dehydrozymosterol
+
** β-(1,4)-mannan degradation
* molecular weight:
+
** 382.628   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** plant mannan degradation
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-11201]]
+
'''2''' reactions found over '''7''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[3.2.1.78-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_8816]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[PHOSMANMUT-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_5802]]
 +
*** [[Tiso_gene_13477]]
 +
*** [[Tiso_gene_14704]]
 +
*** [[Tiso_gene_4816]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.100-RXN 3.2.1.100-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=MANNPISOM-RXN MANNPISOM-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12977 RXN-12977]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15202 RXN-15202]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15344 RXN-15344]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820155 91820155]
+
{{#set: common name=β-(1,4)-mannan degradation}}
{{#set: smiles=CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))}}
+
{{#set: common name=plant mannan degradation}}
{{#set: inchi key=InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N}}
+
{{#set: reaction found=2}}
{{#set: common name=26,27-dehydrozymosterol}}
+
{{#set: total reaction=7}}
{{#set: molecular weight=382.628    }}
+
{{#set: completion rate=29.0}}
{{#set: consumed by=RXN-11201}}
+

Revision as of 14:50, 21 March 2018

Pathway PWY-7456

  • taxonomic range:
  • common name:
    • β-(1,4)-mannan degradation
  • Synonym(s):
    • plant mannan degradation

Reaction(s) found

2 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links