Difference between revisions of "RXN-15089"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] == * smiles: ** C(CC(=O)C(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=FG...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FORMATETHFLIG-RXN FORMATETHFLIG-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzym...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FORMATETHFLIG-RXN FORMATETHFLIG-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/6.3.4.3 EC-6.3.4.3] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[FORMATE]][c] '''+''' 1 [[THF-GLU-N]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[FORMYL-THF-GLU-N]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 formate[c] '''+''' 1 a tetrahydrofolate[c] '''+''' 1 ATP[c] '''=>''' 1 phosphate[c] '''+''' 1 ADP[c] '''+''' 1 an N10-formyl-tetrahydrofolate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_432]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_7582]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-2201]], folate transformations I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2201 PWY-2201] | ||
+ | ** '''7''' reactions found over '''12''' reactions in the full pathway | ||
+ | * [[PWY-1722]], formate assimilation into 5,10-methylenetetrahydrofolate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1722 PWY-1722] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-3841]], folate transformations II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3841 PWY-3841] | ||
+ | ** '''9''' reactions found over '''11''' reactions in the full pathway | ||
+ | * [[CODH-PWY]], reductive acetyl coenzyme A pathway I (homoacetogenic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=CODH-PWY CODH-PWY] | ||
+ | ** '''5''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-2161]], folate polyglutamylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2161 PWY-2161] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20221 20221] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00943 R00943] | |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P09440 P09440] |
− | * | + | ** [http://www.uniprot.org/uniprot/P13419 P13419] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P07245 P07245] |
− | * | + | ** [http://www.uniprot.org/uniprot/P11586 P11586] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P21164 P21164] |
− | * | + | ** [http://www.uniprot.org/uniprot/P28723 P28723] |
− | + | ** [http://www.uniprot.org/uniprot/Q9JVY8 Q9JVY8] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9CH07 Q9CH07] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q07064 Q07064] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q27772 Q27772] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: ec number=EC-6.3.4.3}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_432|Tiso_gene_7582}} |
+ | {{#set: in pathway=PWY-2201|PWY-1722|PWY-3841|CODH-PWY|PWY-2161}} | ||
+ | {{#set: reconstruction category=orthology|manual|annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation|manual-primary_network|annotation-experimental_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 14:50, 21 March 2018
Contents
Reaction FORMATETHFLIG-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 formate[c] + 1 a tetrahydrofolate[c] + 1 ATP[c] => 1 phosphate[c] + 1 ADP[c] + 1 an N10-formyl-tetrahydrofolate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_432
- Source: orthology-esiliculosus
- Gene: Tiso_gene_7582
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
Pathways
- PWY-2201, folate transformations I: PWY-2201
- 7 reactions found over 12 reactions in the full pathway
- PWY-1722, formate assimilation into 5,10-methylenetetrahydrofolate: PWY-1722
- 3 reactions found over 3 reactions in the full pathway
- PWY-3841, folate transformations II: PWY-3841
- 9 reactions found over 11 reactions in the full pathway
- CODH-PWY, reductive acetyl coenzyme A pathway I (homoacetogenic bacteria): CODH-PWY
- 5 reactions found over 9 reactions in the full pathway
- PWY-2161, folate polyglutamylation: PWY-2161
- 5 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: