Difference between revisions of "PWY-6146"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_16385 == * Synonym(s): == Reactions associated == * RXN-10039 ** pantograph-esiliculosus == Pathways associated == * PWY-628...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] == * smiles: ** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_16385 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] ==
 +
* smiles:
 +
** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O
 +
* common name:
 +
** cellotetraose
 +
* inchi key:
 +
** InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N
 +
* molecular weight:
 +
** 666.583   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-10039]]
+
* [[RXN-12305]]
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-6281]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-10039}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-6281}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=170125 170125]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.148760.html 148760]
 +
{{#set: smiles=C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O}}
 +
{{#set: common name=cellotetraose}}
 +
{{#set: inchi key=InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N}}
 +
{{#set: molecular weight=666.583    }}
 +
{{#set: consumed by=RXN-12305}}

Revision as of 14:50, 21 March 2018

Metabolite CPD-13205

  • smiles:
    • C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O
  • common name:
    • cellotetraose
  • inchi key:
    • InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N
  • molecular weight:
    • 666.583
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links