Difference between revisions of "Tiso gene 15067"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7822 PWY-7822] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7822 PWY-7822] ==
−
* smiles:
+
* taxonomic range:
−
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J
+
 
* common name:
 
* common name:
−
** 8-oxo-GTP
+
** chitin degradation III (Serratia)
−
* molecular weight:
+
−
** 535.151   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 8-oxo-guanosine-triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''7''' reactions in the full pathway
−
* [[RXN-11409]]
+
* [[3.2.1.14-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_10265]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-12625]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_1129]]
 +
*** [[Tiso_gene_14122]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12309 RXN-12309]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-18079 RXN-18079]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-18080 RXN-18080]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-18083 RXN-18083]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-18084 RXN-18084]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173271 46173271]
+
{{#set: common name=chitin degradation III (Serratia)}}
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: reaction found=2}}
−
{{#set: inchi key=InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J}}
+
{{#set: total reaction=7}}
−
{{#set: common name=8-oxo-GTP}}
+
{{#set: completion rate=29.0}}
−
{{#set: molecular weight=535.151    }}
+
−
{{#set: common name=8-oxo-guanosine-triphosphate}}
+
−
{{#set: produced by=RXN-11409}}
+

Revision as of 14:51, 21 March 2018

Pathway PWY-7822

  • taxonomic range:
  • common name:
    • chitin degradation III (Serratia)
  • Synonym(s):

Reaction(s) found

2 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15067&oldid=30709"