Difference between revisions of "Guanine9-in-tRNA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == * smiles: ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O * inchi key: *...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661 PWY-3661] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661 PWY-3661] ==
−
* smiles:
+
* taxonomic range:
−
** C(C([N+])C(=O)[O-])SS([O-])(=O)=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
** InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** S-sulfo-L-cysteine
+
** glycine betaine degradation I
−
* molecular weight:
+
−
** 200.204   
+
 
* Synonym(s):
 
* Synonym(s):
−
** S-sulfocysteine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''7''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[DIMETHYLGLYCINE-DEHYDROGENASE-RXN]]
−
* [[SULFOCYS-RXN]]
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_2717]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[GLYOHMETRANS-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_16153]]
 +
*** [[Tiso_gene_7776]]
 +
*** [[Tiso_gene_18652]]
 +
*** [[Tiso_gene_16154]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-15124]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-15127]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.5-RXN 2.1.1.5-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15125 RXN-15125]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=SARCOX-RXN SARCOX-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203408 25203408]
+
{{#set: taxonomic range=TAX-2157}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62225 62225]
+
{{#set: common name=glycine betaine degradation I}}
−
* LIGAND-CPD:
+
{{#set: reaction found=4}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05824 C05824]
+
{{#set: total reaction=7}}
−
* HMDB : HMDB00731
+
{{#set: completion rate=57.0}}
−
{{#set: smiles=C(C([N+])C(=O)[O-])SS([O-])(=O)=O}}
+
−
{{#set: inchi key=InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M}}
+
−
{{#set: common name=S-sulfo-L-cysteine}}
+
−
{{#set: molecular weight=200.204    }}
+
−
{{#set: common name=S-sulfocysteine}}
+
−
{{#set: reversible reaction associated=SULFOCYS-RXN}}
+

Revision as of 14:51, 21 March 2018

Pathway PWY-3661

Reaction(s) found

4 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Guanine9-in-tRNA&oldid=30785"