Difference between revisions of "E-"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) * in...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NONAPRENYL-4-HYDROXYBENZOATE NONAPRENYL-4-HYDROXYBENZOATE] == * smiles: ** CC(=CCCC(=CCCC(=CCCC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NONAPRENYL-4-HYDROXYBENZOATE NONAPRENYL-4-HYDROXYBENZOATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C)C |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** 3 | + | ** 3-nonaprenyl-4-hydroxybenzoate |
| + | * inchi key: | ||
| + | ** InChIKey=YKKKMRBEPIZPBH-XWEAJCOCSA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 750.178 |
* Synonym(s): | * Synonym(s): | ||
| − | ** 3 | + | ** 3-solanesyl-4-hydroxybenzoate |
| − | ** | + | ** nonaprenyl-4-hydroxybenzoic acid |
| − | ** | + | ** 3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl ester |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[R600]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.5.1.39-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54746221 54746221] |
| − | * | + | * HMDB : HMDB32488 |
| − | ** [http://www. | + | * CHEBI: |
| − | {{#set: smiles= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84502 84502] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03885 C03885] |
| − | {{#set: molecular weight= | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C)C}} |
| − | {{#set: common name=3 | + | {{#set: common name=3-nonaprenyl-4-hydroxybenzoate}} |
| − | {{#set: consumed by= | + | {{#set: inchi key=InChIKey=YKKKMRBEPIZPBH-XWEAJCOCSA-M}} |
| + | {{#set: molecular weight=750.178 }} | ||
| + | {{#set: common name=3-solanesyl-4-hydroxybenzoate|nonaprenyl-4-hydroxybenzoic acid|3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl ester}} | ||
| + | {{#set: consumed by=R600}} | ||
| + | {{#set: produced by=2.5.1.39-RXN}} | ||
Revision as of 14:52, 21 March 2018
Contents
Metabolite NONAPRENYL-4-HYDROXYBENZOATE
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C)C
- common name:
- 3-nonaprenyl-4-hydroxybenzoate
- inchi key:
- InChIKey=YKKKMRBEPIZPBH-XWEAJCOCSA-M
- molecular weight:
- 750.178
- Synonym(s):
- 3-solanesyl-4-hydroxybenzoate
- nonaprenyl-4-hydroxybenzoic acid
- 3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl ester
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.
