Difference between revisions of "Cyclic-Phosphate-Terminated-RNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=P-PANTOCYSDECARB-RXN P-PANTOCYSDECARB-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http:/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] == * smiles: ** CC(C(=O)CC(=O)[O-])CC(=O)[O-] * common name: ** 4-methyl-3...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=P-PANTOCYSDECARB-RXN P-PANTOCYSDECARB-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C(=O)CC(=O)[O-])CC(=O)[O-]
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/4.1.1.36 EC-4.1.1.36]
+
** 4-methyl-3-oxoadipate
 +
* inchi key:
 +
** InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L
 +
* molecular weight:
 +
** 172.137   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4-methyl-3-ketoadipate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[PANTETHEINE-P]][c]
+
* [[RXN-10083]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 R-4'-phosphopantothenoyl-L-cysteine[c] '''=>''' 1 CO2[c] '''+''' 1 4'-phosphopantetheine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_15171]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
== Pathways  ==
+
−
* [[COA-PWY-1]], coenzyme A biosynthesis II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=COA-PWY-1 COA-PWY-1]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[COA-PWY]], coenzyme A biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=COA-PWY COA-PWY]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-athaliana]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-synechocystis]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16793 16793]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123441 44123441]
−
* LIGAND-RXN:
+
{{#set: smiles=CC(C(=O)CC(=O)[O-])CC(=O)[O-]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R03269 R03269]
+
{{#set: common name=4-methyl-3-oxoadipate}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L}}
−
{{#set: ec number=EC-4.1.1.36}}
+
{{#set: molecular weight=172.137    }}
−
{{#set: gene associated=Tiso_gene_15171}}
+
{{#set: common name=4-methyl-3-ketoadipate}}
−
{{#set: in pathway=COA-PWY-1|COA-PWY}}
+
{{#set: produced by=RXN-10083}}
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction source=orthology-athaliana|orthology-synechocystis}}
+
−
{{#set: reconstruction tool=pantograph}}
+

Revision as of 15:52, 21 March 2018

Metabolite CPD-10826

  • smiles:
    • CC(C(=O)CC(=O)[O-])CC(=O)[O-]
  • common name:
    • 4-methyl-3-oxoadipate
  • inchi key:
    • InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L
  • molecular weight:
    • 172.137
  • Synonym(s):
    • 4-methyl-3-ketoadipate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C(=O)CC(=O)[O-])CC(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cyclic-Phosphate-Terminated-RNAs&oldid=30913"