Difference between revisions of "PWY-5517"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * smiles: ** C(S([O-])=O)C(=O)C(=O)[O-] * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5489 PWY-5489] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-12...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5489 PWY-5489] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** methyl parathion degradation |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''1''' reactions in the full pathway | |
| − | + | * [[RXN-8743]] | |
| − | * [[ | + | ** 1 associated gene(s): |
| + | *** [[Tiso_gene_9894]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-1224}} | |
| − | + | {{#set: common name=methyl parathion degradation}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=1}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 14:53, 21 March 2018
Pathway PWY-5489
- taxonomic range:
- common name:
- methyl parathion degradation
- Synonym(s):
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- RXN-8743
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
