Difference between revisions of "Tiso gene 1420"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13524 CPD-13524] == * smiles: ** CC(=CC=CC(C)=CCO)C=CC1(=C(C)CCCC(C)(C)1) * inchi key: ** I...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5517 PWY-5517] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5517 PWY-5517] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** L-arabinose degradation III |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''6''' reactions in the full pathway |
− | * [[ | + | * [[RXN-14809]] |
− | == Reaction(s) | + | ** 0 associated gene: |
− | * [ | + | ** 1 reconstruction source(s) associated: |
− | + | *** [[annotation-in-silico_annotation]] | |
− | * [ | + | == Reaction(s) not found == |
− | = | + | * [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.43-RXN 4.2.1.43-RXN] |
− | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=L-ARABINONATE-DEHYDRATASE-RXN L-ARABINONATE-DEHYDRATASE-RXN] |
+ | * [http://metacyc.org/META/NEW-IMAGE?object=L-ARABINONOLACTONASE-RXN L-ARABINONOLACTONASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8774 RXN-8774] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8775 RXN-8775] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=L-arabinose degradation III}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=17.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 14:53, 21 March 2018
Pathway PWY-5517
- taxonomic range:
- common name:
- L-arabinose degradation III
- Synonym(s):
Reaction(s) found
1 reactions found over 6 reactions in the full pathway
- RXN-14809
- 0 associated gene:
- 1 reconstruction source(s) associated: