Difference between revisions of "Tiso gene 568"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == * smiles: ** C(C=CC1(=C(C=CC=C1)O))(=O)[O-] * inchi key: ** InChIKey=PMOW...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6458 PWY-6458] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6458 PWY-6458] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** benzoyl-CoA biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** benzoyl-coenzyme A biosynthesis |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''1''' reactions found over '''3''' reactions in the full pathway |
− | + | * [[RXN-2006]] | |
− | * [[ | + | ** 1 associated gene(s): |
− | == Reaction(s) | + | *** [[Tiso_gene_16181]] |
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-2002 RXN-2002] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-2003 RXN-2003] | ||
== External links == | == External links == | ||
− | * | + | * PLANTCYC : PWY-6458 |
− | + | {{#set: taxonomic range=TAX-3193}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=benzoyl-CoA biosynthesis}} | |
− | + | {{#set: common name=benzoyl-coenzyme A biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:53, 21 March 2018
Pathway PWY-6458
- taxonomic range:
- common name:
- benzoyl-CoA biosynthesis
- Synonym(s):
- benzoyl-coenzyme A biosynthesis
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RXN-2006
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- PLANTCYC : PWY-6458