Difference between revisions of "Tiso gene 5008"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18843 == * left end position: ** 7 * transcription direction: ** POSITIVE * right end position: ** 1237 * centisome position: ** 0.25343955...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] == * smiles: ** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) * c...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] == |
− | * | + | * smiles: |
− | ** | + | ** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) |
− | * | + | * common name: |
− | ** | + | ** mycophenolate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 319.333 |
* Synonym(s): | * Synonym(s): | ||
+ | ** mycophenolic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-13608]] |
− | * | + | * [[RXN-13607]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6918995 6918995] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62932 62932] |
− | {{#set: | + | {{#set: smiles=CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)}} |
+ | {{#set: common name=mycophenolate}} | ||
+ | {{#set: inchi key=InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M}} | ||
+ | {{#set: molecular weight=319.333 }} | ||
+ | {{#set: common name=mycophenolic acid}} | ||
+ | {{#set: consumed by=RXN-13608|RXN-13607}} |
Revision as of 15:54, 21 March 2018
Contents
Metabolite CPD-14601
- smiles:
- CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)
- common name:
- mycophenolate
- inchi key:
- InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M
- molecular weight:
- 319.333
- Synonym(s):
- mycophenolic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)" cannot be used as a page name in this wiki.