Difference between revisions of "Tiso gene 18807"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUC SUC] == * smiles: ** C(C([O-])=O)CC([O-])=O * inchi key: ** InChIKey=KDYFGRWQOYBRFD-UHFFFAO...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-DEOXY-D-GLUCARATE 2-KETO-3-DEOXY-D-GLUCARATE] == * smiles: ** C(C(CC(C(C([O-])=O)O)O)=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-DEOXY-D-GLUCARATE 2-KETO-3-DEOXY-D-GLUCARATE] == |
* smiles: | * smiles: | ||
− | ** C(C([O-])=O) | + | ** C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (2S,3S)-2,3-dihydroxy-5-oxohexanedioate |
+ | * inchi key: | ||
+ | ** InChIKey=QUURPCHWPQNNGL-OKKQSCSOSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 190.109 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-deoxy-L-allo-hex-2-ulosarate |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[4.1.2.20-RXN]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245202 25245202] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58098 58098] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles=C(C([O-])=O) | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03921 C03921] |
− | {{#set: | + | {{#set: smiles=C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O}} |
− | {{#set: | + | {{#set: common name=(2S,3S)-2,3-dihydroxy-5-oxohexanedioate}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=QUURPCHWPQNNGL-OKKQSCSOSA-L}} |
− | {{#set: common name= | + | {{#set: molecular weight=190.109 }} |
− | + | {{#set: common name=3-deoxy-L-allo-hex-2-ulosarate}} | |
− | + | {{#set: reversible reaction associated=4.1.2.20-RXN}} | |
− | {{#set: reversible reaction associated= | + |
Revision as of 15:54, 21 March 2018
Contents
Metabolite 2-KETO-3-DEOXY-D-GLUCARATE
- smiles:
- C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O
- common name:
- (2S,3S)-2,3-dihydroxy-5-oxohexanedioate
- inchi key:
- InChIKey=QUURPCHWPQNNGL-OKKQSCSOSA-L
- molecular weight:
- 190.109
- Synonym(s):
- 3-deoxy-L-allo-hex-2-ulosarate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O" cannot be used as a page name in this wiki.