Difference between revisions of "Tiso gene 8889"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7312 PWY-7312] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-543 TAX-543...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7312 PWY-7312] ==
−
* smiles:
+
* taxonomic range:
−
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-543 TAX-543]
 
* common name:
 
* common name:
−
** protochlorophyllide a
+
** dTDP-D-β-fucofuranose biosynthesis
−
* molecular weight:
+
−
** 610.951   
+
 
* Synonym(s):
 
* Synonym(s):
−
** monovinyl protochlorophyllide a
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[R03845]]
+
'''2''' reactions found over '''4''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[DTDPGLUCDEHYDRAT-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
−
* [[RXN1F-10]]
+
*** [[Tiso_gene_7329]]
 +
*** [[Tiso_gene_12394]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[DTDPGLUCOSEPP-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_14704]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-synechocystis]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14532 RXN-14532]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14533 RXN-14533]
 
== External links  ==
 
== External links  ==
−
* CAS : 14751-08-7
+
{{#set: taxonomic range=TAX-543}}
−
* PUBCHEM:
+
{{#set: common name=dTDP-D-β-fucofuranose biosynthesis}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54749448 54749448]
+
{{#set: reaction found=2}}
−
* CHEBI:
+
{{#set: total reaction=4}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57855 57855]
+
{{#set: completion rate=50.0}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02880 C02880]
+
−
* HMDB : HMDB31148
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=protochlorophyllide a}}
+
−
{{#set: molecular weight=610.951    }}
+
−
{{#set: common name=monovinyl protochlorophyllide a}}
+
−
{{#set: consumed by=R03845}}
+
−
{{#set: reversible reaction associated=RXN1F-10}}
+

Revision as of 14:56, 21 March 2018

Pathway PWY-7312

  • taxonomic range:
  • common name:
    • dTDP-D-β-fucofuranose biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8889&oldid=31290"