Difference between revisions of "PWY-7295"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] == * smiles: ** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O) * inchi key:...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-481 RXN1G-481] == * direction: ** LEFT-TO-RIGHT * common name: ** cis,cis-delta15,27-3-oxo-C4...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-481 RXN1G-481] ==
−
* smiles:
+
* direction:
−
** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N
+
 
* common name:
 
* common name:
−
** (S)-equol
+
** cis,cis-delta15,27-3-oxo-C46:2-[acyl-carrier protein] reductase
−
* molecular weight:
+
* ec number:
−
** 242.274   
+
** [http://enzyme.expasy.org/EC/1.1.1.M9 EC-1.1.1.M9]
 
* Synonym(s):
 
* Synonym(s):
−
** 4',7-isoflavandiol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[cis-cis-D15-27-3-oxo-C46-2-ACPs]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[cis-cis-D15-27-3-hydroxyC46-2-ACPs]][c] '''+''' 1 [[NADP]][c]
−
* [[RXN-15589]]
+
* With common name(s):
 +
** 1 a cis,cis-delta15,27-3-oxo-C46:2-[acp][c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 a cis,cis-delta15,27-3-hydroxyC46:2-[acp][c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13083]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C14131 C14131]
+
{{#set: common name=cis,cis-delta15,27-3-oxo-C46:2-[acyl-carrier protein] reductase}}
−
* Wikipedia : Equol
+
{{#set: ec number=EC-1.1.1.M9}}
−
* HMDB : HMDB02209
+
{{#set: gene associated=Tiso_gene_13083}}
−
* CHEBI:
+
{{#set: in pathway=PWYG-321}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34741 34741]
+
{{#set: reconstruction category=orthology}}
−
* PUBCHEM:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91469 91469]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O)}}
+
−
{{#set: inchi key=InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N}}
+
−
{{#set: common name=(S)-equol}}
+
−
{{#set: molecular weight=242.274    }}
+
−
{{#set: common name=4',7-isoflavandiol}}
+
−
{{#set: reversible reaction associated=RXN-15589}}
+

Revision as of 14:56, 21 March 2018

Reaction RXN1G-481

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cis,cis-delta15,27-3-oxo-C46:2-[acyl-carrier protein] reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"cis,cis-delta15,27-3-oxo-C46:2-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7295&oldid=31305"