Difference between revisions of "Tiso gene 16918"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_16490 == * left end position: ** 443 * transcription direction: ** NEGATIVE * right end position: ** 3521 * centisome position: ** 10.25225...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_16490 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] ==
−
* left end position:
+
* smiles:
−
** 443
+
** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** ω-saturated C55 dolichol phosphate
−
* right end position:
+
* inchi key:
−
** 3521
+
** InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L
−
* centisome position:
+
* molecular weight:
−
** 10.252256    
+
** 849.311    
 
* Synonym(s):
 
* Synonym(s):
 +
** ω-saturated dolichol-11 phosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.5.1.98-RXN]]
+
* [[RXN-16602]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=443}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819874 91819874]
−
{{#set: right end position=3521}}
+
{{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C}}
−
{{#set: centisome position=10.252256   }}
+
{{#set: common name=ω-saturated C55 dolichol phosphate}}
−
{{#set: reaction associated=3.5.1.98-RXN}}
+
{{#set: inchi key=InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L}}
 +
{{#set: molecular weight=849.311   }}
 +
{{#set: common name=ω-saturated dolichol-11 phosphate}}
 +
{{#set: consumed by=RXN-16602}}

Revision as of 14:56, 21 March 2018

Metabolite CPD-17858

  • smiles:
    • CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C
  • common name:
    • ω-saturated C55 dolichol phosphate
  • inchi key:
    • InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L
  • molecular weight:
    • 849.311
  • Synonym(s):
    • ω-saturated dolichol-11 phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16918&oldid=31310"