Difference between revisions of "Tiso gene 9846"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_4452 == * left end position: ** 11451 * transcription direction: ** POSITIVE * right end position: ** 13042 * centisome position: ** 77.246...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] == * smiles: ** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_4452 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] ==
−
* left end position:
+
* smiles:
−
** 11451
+
** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** 7-dehydrocholesterol
−
* right end position:
+
* inchi key:
−
** 13042
+
** InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N
−
* centisome position:
+
* molecular weight:
−
** 77.24635    
+
** 384.644    
 
* Synonym(s):
 
* Synonym(s):
 +
** cholesta-5,7-dien-3 β-ol
 +
** cholesta-5,7-dienol
 +
** 7-dehydro-cholesterol
 +
** cholesta-5,7-dien-3β-ol
 +
** provitamin D3
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
+
* [[RXN66-323]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[1.14.21.6-RXN]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=11451}}
+
* CAS : 434-16-2
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=13042}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439423 439423]
−
{{#set: centisome position=77.24635   }}
+
* HMDB : HMDB00032
−
{{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17759 17759]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01164 C01164]
 +
{{#set: smiles=CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))}}
 +
{{#set: common name=7-dehydrocholesterol}}
 +
{{#set: inchi key=InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N}}
 +
{{#set: molecular weight=384.644   }}
 +
{{#set: common name=cholesta-5,7-dien-3 β-ol|cholesta-5,7-dienol|7-dehydro-cholesterol|cholesta-5,7-dien-3β-ol|provitamin D3}}
 +
{{#set: consumed by=RXN66-323}}
 +
{{#set: produced by=1.14.21.6-RXN}}

Revision as of 15:56, 21 March 2018

Metabolite CPD-4187

  • smiles:
    • CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))
  • common name:
    • 7-dehydrocholesterol
  • inchi key:
    • InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N
  • molecular weight:
    • 384.644
  • Synonym(s):
    • cholesta-5,7-dien-3 β-ol
    • cholesta-5,7-dienol
    • 7-dehydro-cholesterol
    • cholesta-5,7-dien-3β-ol
    • provitamin D3

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9846&oldid=31324"