Difference between revisions of "NUCLEOSIDE-DIP-KIN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == * smiles: ** C(NC(=O)C(CSC=O)NC(=O)CCC([N+])C(=O)[O-])C(=O)[O-] * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11201 RXN-11201] == * direction: ** LEFT-TO-RIGHT * common name: ** sterol 24C methyltransferas...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11201 RXN-11201] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** sterol 24C methyltransferase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[S- | + | * With identifiers: |
− | + | ** 1.0 [[CPD-12159]][c] '''+''' 1.0 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1.0 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1.0 [[CPD-12160]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1.0 26,27-dehydrozymosterol[c] '''+''' 1.0 S-adenosyl-L-methionine[c] '''=>''' 1.0 S-adenosyl-L-homocysteine[c] '''+''' 1.0 24-alkyl sterol 1[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_10757]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_19883]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_10659]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_8895]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_11071]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_14051]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_3977]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_13974]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_15903]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_8634]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_13588]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=sterol 24C methyltransferase}} | |
− | + | {{#set: gene associated=Tiso_gene_10757|Tiso_gene_19883|Tiso_gene_10659|Tiso_gene_8895|Tiso_gene_11071|Tiso_gene_14051|Tiso_gene_3977|Tiso_gene_13974|Tiso_gene_15903|Tiso_gene_8634|Tiso_gene_13588}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:56, 21 March 2018
Contents
Reaction RXN-11201
- direction:
- LEFT-TO-RIGHT
- common name:
- sterol 24C methyltransferase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 CPD-12159[c] + 1.0 S-ADENOSYLMETHIONINE[c] => 1.0 ADENOSYL-HOMO-CYS[c] + 1.0 CPD-12160[c]
- With common name(s):
- 1.0 26,27-dehydrozymosterol[c] + 1.0 S-adenosyl-L-methionine[c] => 1.0 S-adenosyl-L-homocysteine[c] + 1.0 24-alkyl sterol 1[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10757
- Source: orthology-esiliculosus
- Gene: Tiso_gene_19883
- Source: orthology-esiliculosus
- Gene: Tiso_gene_10659
- Source: orthology-esiliculosus
- Gene: Tiso_gene_8895
- Source: orthology-esiliculosus
- Gene: Tiso_gene_11071
- Source: orthology-esiliculosus
- Gene: Tiso_gene_14051
- Source: orthology-esiliculosus
- Gene: Tiso_gene_3977
- Source: orthology-esiliculosus
- Gene: Tiso_gene_13974
- Source: orthology-esiliculosus
- Gene: Tiso_gene_15903
- Source: orthology-esiliculosus
- Gene: Tiso_gene_8634
- Source: orthology-esiliculosus
- Gene: Tiso_gene_13588
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus