Difference between revisions of "Tiso gene 17319"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8984 CPD-8984] == * smiles: ** C3(C=CC(C2(C(C1(C=CC=CC=1))O2))=CC=3) * inchi key: ** InChIK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IODINE-MOLECULE IODINE-MOLECULE] == * smiles: ** II * common name: ** I2 * inchi key: ** InChIK...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IODINE-MOLECULE IODINE-MOLECULE] == |
* smiles: | * smiles: | ||
− | ** | + | ** II |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** I2 |
+ | * inchi key: | ||
+ | ** InChIKey=PNDPGZBMCMUPRI-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 253.809 |
* Synonym(s): | * Synonym(s): | ||
+ | ** iodine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[TransportSeed_IODINE-MOLECULE]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[TransportSeed_IODINE-MOLECULE]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[ExchangeSeed_IODINE-MOLECULE]] |
== External links == | == External links == | ||
+ | * DRUGBANK : DB05382 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=807 807] |
+ | * HMDB : HMDB00675 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01382 C01382] | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.785.html 785] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17606 17606] |
− | + | {{#set: smiles=II}} | |
− | + | {{#set: common name=I2}} | |
− | + | {{#set: inchi key=InChIKey=PNDPGZBMCMUPRI-UHFFFAOYSA-N}} | |
− | {{#set: | + | {{#set: molecular weight=253.809 }} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=iodine}} |
− | {{#set: common name= | + | {{#set: consumed by=TransportSeed_IODINE-MOLECULE}} |
− | {{#set: | + | {{#set: produced by=TransportSeed_IODINE-MOLECULE}} |
− | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=ExchangeSeed_IODINE-MOLECULE}} |
Revision as of 14:58, 21 March 2018
Contents
Metabolite IODINE-MOLECULE
- smiles:
- II
- common name:
- I2
- inchi key:
- InChIKey=PNDPGZBMCMUPRI-UHFFFAOYSA-N
- molecular weight:
- 253.809
- Synonym(s):
- iodine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links