Difference between revisions of "RXN0-2381"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] == * smiles: ** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3)))...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2)) * inchi key: ** I...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 7,8-dihydromonapterin |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 255.233 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** DHM |
| + | ** H2-MPt | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-10857]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C21008 C21008] |
| − | {{#set: smiles= | + | * CHEBI: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71175 71175] |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: molecular weight= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479435 45479435] |
| − | {{#set: common name= | + | {{#set: smiles=C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2))}} |
| − | {{#set: produced by= | + | {{#set: inchi key=InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N}} |
| + | {{#set: common name=7,8-dihydromonapterin}} | ||
| + | {{#set: molecular weight=255.233 }} | ||
| + | {{#set: common name=DHM|H2-MPt}} | ||
| + | {{#set: consumed or produced by=RXN-10857}} | ||
Revision as of 16:08, 10 January 2018
Contents
Metabolite CPD-11770
- smiles:
- C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2))
- inchi key:
- InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N
- common name:
- 7,8-dihydromonapterin
- molecular weight:
- 255.233
- Synonym(s):
- DHM
- H2-MPt
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
