Difference between revisions of "Tiso gene 1435"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == * smiles: ** CC(=CCCC(=CCOP([O-])(OP(=O)([O-])[O-])=O)C)C * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN 35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN] == * direction: ** LEFT-TO...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN 35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.4.35 EC-3.1.4.35] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[CGMP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[GMP]][c] '''+''' 1 [[PROTON]][c] |
− | + | * With common name(s): | |
− | * [[ | + | ** 1 cyclic-GMP[c] '''+''' 1 H2O[c] '''=>''' 1 GMP[c] '''+''' 1 H+[c] |
− | == | + | |
− | * [[ | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_9644]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_13785]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_12792]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16957 16957] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01234 R01234] | |
− | + | * UNIPROT: | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/P04972 P04972] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P16586 P16586] |
− | * | + | ** [http://www.uniprot.org/uniprot/P23439 P23439] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P35913 P35913] |
− | * | + | ** [http://www.uniprot.org/uniprot/P33726 P33726] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P09174 P09174] |
− | * | + | ** [http://www.uniprot.org/uniprot/P52731 P52731] |
− | + | ** [http://www.uniprot.org/uniprot/P51160 P51160] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P18545 P18545] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O76074 O76074] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P11541 P11541] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P27664 P27664] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q62037 Q62037] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P23440 P23440] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
+ | {{#set: ec number=EC-3.1.4.35}} | ||
+ | {{#set: gene associated=Tiso_gene_9644|Tiso_gene_13785|Tiso_gene_12792}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-creinhardtii}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Revision as of 14:58, 21 March 2018
Contents
Reaction 35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 cyclic-GMP[c] + 1 H2O[c] => 1 GMP[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_9644
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
- Gene: Tiso_gene_13785
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
- Gene: Tiso_gene_12792
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: