Difference between revisions of "Tiso gene 19691"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12711 == * Synonym(s): == Reactions associated == * ADENOSINETRIPHOSPHATASE-RXN ** pantograph-esiliculosus == Pathways associa...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13357 CPD-13357] == * smiles: ** CC(C)(O)C(O)C(=O)[O-] * common name: ** (2R)-2,3-dihydroxy...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13357 CPD-13357] == |
| + | * smiles: | ||
| + | ** CC(C)(O)C(O)C(=O)[O-] | ||
| + | * common name: | ||
| + | ** (2R)-2,3-dihydroxy-3-methylbutanoate | ||
| + | * inchi key: | ||
| + | ** InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M | ||
| + | * molecular weight: | ||
| + | ** 133.124 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (R)-2,3-dihydroxy-3-methylbutanoate | ||
| + | ** (R)-2,3-dihydroxy-isovalerate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[DMHL]] |
| − | ** [[ | + | * [[DHAD_3mob_h]] |
| − | == | + | * [[DHAD_3mob]] |
| + | * [[DIHYDROXYISOVALDEHYDRAT-RXN]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | * [[ACETOLACTREDUCTOISOM-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: reaction associated= | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04272 C04272] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.19951355.html 19951355] | ||
| + | * HMDB : HMDB12141 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49072 49072] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615351 23615351] | ||
| + | {{#set: smiles=CC(C)(O)C(O)C(=O)[O-]}} | ||
| + | {{#set: common name=(2R)-2,3-dihydroxy-3-methylbutanoate}} | ||
| + | {{#set: inchi key=InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M}} | ||
| + | {{#set: molecular weight=133.124 }} | ||
| + | {{#set: common name=(R)-2,3-dihydroxy-3-methylbutanoate|(R)-2,3-dihydroxy-isovalerate}} | ||
| + | {{#set: consumed by=DMHL|DHAD_3mob_h|DHAD_3mob|DIHYDROXYISOVALDEHYDRAT-RXN}} | ||
| + | {{#set: reversible reaction associated=ACETOLACTREDUCTOISOM-RXN}} | ||
Revision as of 14:59, 21 March 2018
Contents
Metabolite CPD-13357
- smiles:
- CC(C)(O)C(O)C(=O)[O-]
- common name:
- (2R)-2,3-dihydroxy-3-methylbutanoate
- inchi key:
- InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M
- molecular weight:
- 133.124
- Synonym(s):
- (R)-2,3-dihydroxy-3-methylbutanoate
- (R)-2,3-dihydroxy-isovalerate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.
