Difference between revisions of "CYSTINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] == * smiles: ** CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACHMSSELCYSL ACHMSSELCYSL] == * direction: ** LEFT-TO-RIGHT * common name: ** O-Acetylhomoserine su...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACHMSSELCYSL ACHMSSELCYSL] ==
−
* smiles:
+
* direction:
−
** CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J
+
 
* common name:
 
* common name:
−
** 5-methyl-3-oxo-4-hexenoyl-CoA
+
** O-Acetylhomoserine succinate-lyase (adding cysteine), cytosol
−
* molecular weight:
+
−
** 887.641   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11921]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[L-SELENOCYSTEINE]][c] '''+''' 1.0 [[CPD-667]][c] '''=>''' 1.0 [[ACET]][c] '''+''' 1.0 [[CPD-13717]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 L-selenocysteine[c] '''+''' 1.0 O-acetyl-L-homoserine[c] '''=>''' 1.0 acetate[c] '''+''' 1.0 L-selenocystathionine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3732]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986120 50986120]
+
{{#set: common name=O-Acetylhomoserine succinate-lyase (adding cysteine), cytosol}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_3732}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16471 C16471]
+
{{#set: in pathway=}}
−
* HMDB : HMDB60399
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: inchi key=InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=5-methyl-3-oxo-4-hexenoyl-CoA}}
+
−
{{#set: molecular weight=887.641    }}
+
−
{{#set: consumed by=RXN-11921}}
+

Revision as of 15:01, 21 March 2018

Reaction ACHMSSELCYSL

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • O-Acetylhomoserine succinate-lyase (adding cysteine), cytosol
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 L-selenocysteine[c] + 1.0 O-acetyl-L-homoserine[c] => 1.0 acetate[c] + 1.0 L-selenocystathionine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CYSTINE&oldid=31805"