Difference between revisions of "RXN-16389"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10337 CPD-10337] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6151 PWY-6151] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10337 CPD-10337] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6151 PWY-6151] ==
−
* smiles:
+
* taxonomic range:
−
** C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** chlorophyll c2
+
** S-adenosyl-L-methionine cycle I
−
* molecular weight:
+
−
** 606.919   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** SAM cycle
 +
** activated methyl cycle
 +
** AMC
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''6''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]]
−
* [[RXN-17487]]
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_14191]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[HOMOCYSMET-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_1602]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-7605]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
* [[SAM-PWY]]
 +
** 0 associated gene:
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RIBOSYLHOMOCYSTEINASE-RXN RIBOSYLHOMOCYSTEINASE-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244281 25244281]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6151 PWY-6151]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38203 38203]
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=S-adenosyl-L-methionine cycle I}}
−
{{#set: common name=chlorophyll c2}}
+
{{#set: common name=SAM cycle|activated methyl cycle|AMC}}
−
{{#set: molecular weight=606.919    }}
+
{{#set: reaction found=4}}
−
{{#set: reversible reaction associated=RXN-17487}}
+
{{#set: total reaction=6}}
 +
{{#set: completion rate=67.0}}

Revision as of 15:01, 21 March 2018

Pathway PWY-6151

  • taxonomic range:
  • common name:
    • S-adenosyl-L-methionine cycle I
  • Synonym(s):
    • SAM cycle
    • activated methyl cycle
    • AMC

Reaction(s) found

4 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-16389&oldid=31838"