Difference between revisions of "RXN-14271"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] == * smiles: ** C=C(C1(CCC2(C(C1)O2)(C)))C * inchi key: ** InChIKey=CCEFMU...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.78-RXN 3.2.1.78-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** endo-beta-_-mannanase...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.78-RXN 3.2.1.78-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** endo-beta-_-mannanase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.2.1.78 EC-3.2.1.78] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 1 [[1-4-Mannan]][c] '''+''' 1 [[WATER]][c] '''=>''' 2 [[Short-Mannan]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 a β-(1,4)-D-mannan[c] '''+''' 1 H2O[c] '''=>''' 2 a β-(1,4)-mannan oligosaccharide[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_8816]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-7456]], β-(1,4)-mannan degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7456 PWY-7456] | ||
+ | ** '''2''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P16699 P16699] |
− | * | + | ** [http://www.uniprot.org/uniprot/P22533 P22533] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O66185 O66185] |
− | * | + | ** [http://www.uniprot.org/uniprot/O48540 O48540] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9M0H6 Q9M0H6] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P49425 P49425] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=endo-beta-_-mannanase}} |
− | {{#set: | + | {{#set: ec number=EC-3.2.1.78}} |
+ | {{#set: gene associated=Tiso_gene_8816}} | ||
+ | {{#set: in pathway=PWY-7456}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 15:01, 21 March 2018
Contents
Reaction 3.2.1.78-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- endo-beta-_-mannanase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 1-4-Mannan[c] + 1 WATER[c] => 2 Short-Mannan[c]
- With common name(s):
- 1 a β-(1,4)-D-mannan[c] + 1 H2O[c] => 2 a β-(1,4)-mannan oligosaccharide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_8816
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
- PWY-7456, β-(1,4)-mannan degradation: PWY-7456
- 2 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links